| Name |
Bryophyllin B |
| Formula |
C26H34O9 |
| Mw |
490.22028269 |
| CAS RN |
125339-13-1 |
| C_ID |
C00063740
|
| InChIKey |
IJJFGJIZGZSCBF-JBYNNAELSA-N |
| InChICode |
InChI=1S/C26H34O9/c1-13(27)34-19-9-15(28)10-24(31)7-5-17-21-18(35-22(30)26(19,21)24)11-23(2)16(6-8-25(17,23)32)14-3-4-20(29)33-12-14/h3-4,12,15-19,21-22,28,30-32H,5-11H2,1-2H3/t15-,16+,17?,18+,19?,21?,22+,23+,24-,25-,26?/m0/s1 |
| SMILES |
CC(=O)OC1CC(O)CC2(O)CCC3C4C(CC5(C)C(c6ccc(=O)oc6)CCC35O)OC(O)C142 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Bryophyllum pinnatum  | Ref. |
| Plantae | Crassulaceae | Kalanchoe gracilis | Ref. |
|
|
zoom in
| Organism | Kalanchoe gracilis |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
