| Name |
4'-Demethylpodophyllotoxone |
| Formula |
C21H20O7 |
| Mw |
384.12090299 |
| CAS RN |
123695-67-0 |
| C_ID |
C00063727
|
| InChIKey |
RKRCKXOGXOLIJI-CKFHNAJUSA-N |
| InChICode |
InChI=1S/C21H20O7/c1-24-17-3-10(4-18(25-2)21(17)23)19-11-5-15-16(28-9-27-15)6-12(11)20(22)14-8-26-7-13(14)19/h3-6,13-14,19,23H,7-9H2,1-2H3/t13-,14-,19+/m0/s1 |
| SMILES |
COc1cc(C2c3cc4c(cc3C(=O)C3COCC32)OCO4)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Podophyllum hexandrum  | Ref. |
| Plantae | Berberidaceae | Podophyllum peltatum  | Ref. |
|
|
zoom in
| Organism | Podophyllum peltatum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|