| Name |
Piceid gallate A |
| Formula |
C27H26O13 |
| Mw |
558.13734092 |
| CAS RN |
1149378-77-7 |
| C_ID |
C00063671
|
| InChIKey |
UNJSQZHHRSMQID-XMPPFBFMSA-N |
| InChICode |
InChI=1S/C27H26O13/c28-11-21-23(35)24(36)25(40-26(37)14-8-19(32)22(34)20(33)9-14)27(39-21)38-16-6-13(5-15(29)10-16)2-1-12-3-4-17(30)18(31)7-12/h1-10,21,23-25,27-36H,11H2/b2-1+/t21-,23-,24+,25-,27-/m1/s1 |
| SMILES |
O=C(OC1C(Oc2cc(O)cc(C=Cc3ccc(O)c(O)c3)c2)OC(CO)C(O)C1O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polygonaceae | Polygonum sachalinensis | Ref. |
|
|
zoom in
| Organism | Polygonum sachalinensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|