| Name |
Przewanoic acid B |
| Formula |
C29H42O4 |
| Mw |
454.30830983 |
| CAS RN |
113540-93-5 |
| C_ID |
C00063663
|
| InChIKey |
BFOAWZGRXLZRCM-XWIYUPEGSA-N |
| InChICode |
InChI=1S/C29H42O4/c1-16-18-6-8-26(4)20-7-9-28(24(32)33)11-10-25(2,3)15-22(28)29(20)13-17(29)12-21(26)27(18,5)14-19(30)23(16)31/h7,17-19,21-23,30-31H,1,6,8-15H2,2-5H3,(H,32,33)/t17-,18+,19-,21+,22-,23+,26+,27+,28-,29-/m1/s1 |
| SMILES |
C=C1C(O)C(O)CC2(C)C1CCC1(C)C3=CCC4(C(=O)O)CCC(C)(C)CC4C34CC4CC12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia bicolor | Ref. |
| Plantae | Labiatae | Salvia palaestina | Ref. |
| Plantae | Labiatae | Salvia sclarea  | Ref. |
| Plantae | Labiatae | Salvia triloba  | Ref. |
|
|
zoom in
| Organism | Salvia palaestina | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|