| Name |
Saligenin |
| Formula |
C7H8O2 |
| Mw |
124.0524295 |
| CAS RN |
90-01-7 |
| C_ID |
C00063576
|
| InChIKey |
CQRYARSYNCAZFO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H8O2/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2 |
| SMILES |
OCc1ccccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Salicaceae | Salix purpurea  | Ref. |
|
|
zoom in
| Organism | Salix purpurea | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|