| Name |
cis-Ferulic acid (Z)-Ferulic acid |
| Formula |
C10H10O4 |
| Mw |
194.05790881 |
| CAS RN |
1014-83-1 |
| C_ID |
C00058916
|
| InChIKey |
KSEBMYQBYZTDHS-HYXAFXHYSA-N |
| InChICode |
InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3- |
| SMILES |
COc1cc(C=CC(=O)O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
|
|
zoom in
| Organism | Scrophularia frutescens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|