| Name |
(-)-Vitisifuran B
Vitisifuran B |
| Formula |
C56H40O12 |
| Mw |
904.25197674 |
| CAS RN |
223558-40-5 |
| C_ID |
C00058023
|
| InChIKey |
QQKYNHZSGKPQKR-IOBYTGNLSA-N |
| InChICode |
InChI=1S/C56H40O12/c57-35-12-6-29(7-13-35)54-49(33-19-38(60)23-39(61)20-33)44-26-43(45(65)27-47(44)67-54)53-50-28(2-1-3-46(50)66-56(53)31-10-16-37(59)17-11-31)4-5-32-18-42(64)25-48-51(32)52(34-21-40(62)24-41(63)22-34)55(68-48)30-8-14-36(58)15-9-30/h1-27,49,53-54,56-65H/b5-4+/t49-,53+,54+,56-/m0/s1 |
| SMILES |
Oc1ccc(-c2oc3cc(O)cc(/C=C/c4cccc5c4[C@@H](c4cc6c(cc4O)O[C@H](c4ccc(O)cc4)[C@H]6c4cc(O)cc(O)c4)[C@H](c4ccc(O)cc4)O5)c3c2-c2cc(O)cc(O)c2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Vitaceae | Vitis amurensis | Ref. |
| Plantae | Vitaceae | Vitis thunbergii | Ref. |
| Plantae | Vitaceae | Vitis vinifera 'Kyohou'  | Ref. |
|
|
zoom in
| Organism | Vitis thunbergii |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
