| Name |
Somniferine |
| Formula |
C36H36N2O7 |
| Mw |
608.25225152 |
| CAS RN |
117611-63-9 |
| C_ID |
C00057801
|
| InChIKey |
JQGBUIZIHWUPHT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C36H36N2O7/c1-37-12-11-35-28-18-5-8-23(39)30(28)44-33(35)29(40)19(15-36(35,41)26(37)14-18)22-16-34-20-7-10-25(43-4)32(34)45-31-24(42-3)9-6-17(27(31)34)13-21(20)38(22)2/h5-10,15,21-22,26,32-33,39,41H,11-14,16H2,1-4H3 |
| SMILES |
COC1=CC=C2C3Cc4ccc(OC)c5c4C2(CC(C2=CC4(O)C6Cc7ccc(O)c8c7C4(CCN6C)C(O8)C2=O)N3C)C1O5 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Solanaceae | Withania somnifera | Ref. |
|
|
zoom in
| Organism | Withania somnifera |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
