| Name |
Pterygospermin Pterygospermine |
| Formula |
C22H18N2O2S2 |
| Mw |
406.08096929 |
| CAS RN |
11054-42-5 |
| C_ID |
C00056848
|
| InChIKey |
QEZYZYBKIIMGDZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H18N2O3S/c25-19-23(15-17-7-3-1-4-8-17)21(26-19)11-13-22(14-12-21)24(20(28)27-22)16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
| SMILES |
O=C1OC2(C=CC3(C=C2)OC(=S)N3Cc2ccccc2)N1Cc1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa pterygosperma  | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
|
|
zoom in
| Organism | Moringa peregrine | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|