| Name |
Pterodontriol B |
| Formula |
C15H28O3 |
| Mw |
256.20384476 |
| CAS RN |
152922-63-9 |
| C_ID |
C00056092
|
| InChIKey |
ODDNJYHUVXKJBI-SQLGEJSKSA-N |
| InChICode |
InChI=1S/C15H28O3/c1-13(2,17)10-5-7-14(3)11(9-10)15(4,18)8-6-12(14)16/h10-12,16-18H,5-9H2,1-4H3/t10-,11+,12+,14+,15+/m1/s1 |
| SMILES |
CC(C)(O)[C@@H]1CC[C@]2(C)[C@@H](O)CC[C@](C)(O)[C@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Celastraceae | Tripterygium regelii | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
|
|
zoom in
| Organism | Datura metel | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|