| Name |
Peonidin |
| Formula |
C16H13O6 |
| Mw |
301.07121315 |
| CAS RN |
18736-36-2 |
| C_ID |
C00056075
|
| InChIKey |
XFDQJKDGGOEYPI-UHFFFAOYSA-O |
| InChICode |
InChI=1S/C16H12O6/c1-21-15-4-8(2-3-11(15)18)16-13(20)7-10-12(19)5-9(17)6-14(10)22-16/h2-7H,1H3,(H3-,17,18,19,20)/p+1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O)c3cc2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum subsp. Andigena  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana spryginii | Ref. |
|
|
zoom in
| Organism | Dioscorea alata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|