| Name |
Oblongifoliagarcinine A |
| Formula |
C17H16O3 |
| Mw |
268.10994438 |
| CAS RN |
1053180-52-1 |
| C_ID |
C00056022
|
| InChIKey |
CCGFYOXYYBRBLH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H16O3/c1-17(2)8-7-12-9-13(10-15(19)16(12)20-17)11-3-5-14(18)6-4-11/h3-10,18-19H,1-2H3 |
| SMILES |
CC1(C)C=Cc2cc(-c3ccc(O)cc3)cc(O)c2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bracteata | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia oblongifolia  | Ref. |
|
|
zoom in
| Organism | Garcinia oblongifolia | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|