| Name |
Guttiferone N |
| Formula |
C38H50O5 |
| Mw |
586.36582471 |
| CAS RN |
1033778-33-4 |
| C_ID |
C00055906
|
| InChIKey |
DMVVPCKVKZAQOX-ORCUYGCWSA-N |
| InChICode |
InChI=1S/C38H50O5/c1-24(2)12-10-13-27(7)19-20-37-23-29(17-16-25(3)4)36(8,9)38(35(37)43,21-18-26(5)6)34(42)31(33(37)41)32(40)28-14-11-15-30(39)22-28/h11-12,14-16,18-19,22,29,39,41H,10,13,17,20-21,23H2,1-9H3/b27-19+/t29-,37-,38+/m0/s1 |
| SMILES |
CC(C)=CCC/C(C)=C/C[C@]12C[C@H](CC=C(C)C)C(C)(C)[C@](CC=C(C)C)(C(=O)C(C(=O)c3cccc(O)c3)=C1O)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia cambogia  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia gummi-gutta | Ref. |
|
|
zoom in
| Organism | Garcinia gummi-gutta | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|