| Name |
Garcicowin B |
| Formula |
C43H58O5 |
| Mw |
654.42842496 |
| CAS RN |
1207533-30-9 |
| C_ID |
C00055862
|
| InChIKey |
XTFPCLRYUHLWLA-LYQFBJAVSA-N |
| InChICode |
InChI=1S/C43H58O5/c1-28(2)14-11-16-32(9)19-20-34-27-42(24-21-30(5)6)38(46)36(37(45)33-17-12-18-35(44)26-33)39(47)43(40(42)48,25-22-31(7)8)41(34,10)23-13-15-29(3)4/h12,14-15,17-19,21-22,26,34,44,46H,11,13,16,20,23-25,27H2,1-10H3/b32-19+/t34-,41+,42+,43-/m1/s1 |
| SMILES |
CC(C)=CCC/C(C)=C/C[C@@H]1C[C@]2(CC=C(C)C)C(=O)[C@@](CC=C(C)C)(C(=O)C(C(=O)c3cccc(O)c3)=C2O)[C@@]1(C)CCC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia cowa  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia schomburgkiana | Ref. |
|
|
zoom in
| Organism | Garcinia schomburgkiana |
|---|
| Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|
