| Name |
Cohulupone |
| Formula |
C19H26O4 |
| Mw |
318.18310932 |
| CAS RN |
1891-34-5 |
| C_ID |
C00055780
|
| InChIKey |
HMEGPOIWNGKXBR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H26O4/c1-11(2)7-9-19(10-8-12(3)4)17(22)14(15(20)13(5)6)16(21)18(19)23/h7-8,13-14H,9-10H2,1-6H3 |
| SMILES |
CC(C)=CCC1(CC=C(C)C)C(=O)C(=O)C(C(=O)C(C)C)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia subelliptica | Ref. |
|
|
zoom in
| Organism | Garcinia subelliptica | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|