| Name |
cis-Chrysanthenyl acetate |
| Formula |
C12H18O2 |
| Mw |
194.13067982 |
| CAS RN |
67999-48-8 |
| C_ID |
C00055775
|
| InChIKey |
UASZOTVHPVEMQR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H18O2/c1-7-5-6-9-11(14-8(2)13)10(7)12(9,3)4/h5,9-11H,6H2,1-4H3 |
| SMILES |
CC(=O)OC1C2CC=C(C)C1C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia herba-alba  | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
|
|
zoom in
| Organism | Artemisia herba-alba | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|