| Name |
Benthaphenone Diphenylmethanone Benzophenone |
| Formula |
C13H10O |
| Mw |
182.07316494 |
| CAS RN |
119-61-9 |
| C_ID |
C00055728
|
| InChIKey |
RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| SMILES |
O=C(c1ccccc1)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia benthami | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
|
|
zoom in
| Organism | Garcinia benthami | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|