| Name |
1,7-Bis(4-hydroxy-3-methoxyphenyl)-3,5-heptanedione Tetrahydrocurcumin |
| Formula |
C21H24O6 |
| Mw |
372.1572885 |
| CAS RN |
36062-04-1 |
| C_ID |
C00055176
|
| InChIKey |
HZSBKDOTUYISNN-FCXRPNKRSA-N |
| InChICode |
InChI=1S/C21H24O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-5,7-9,11-12,15,19,24-25H,6,10,13H2,1-2H3/b7-3+,8-4+ |
| SMILES |
COC1=CC(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)CCC1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Zingiber mioga  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber mioga | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|