| Name |
2-Formyl-1-hydroxyanthraquinone 9,10-Dihydro-1-hydroxy-9,10-dioxo-2-anthracenecarboxaldehyde |
| Formula |
C15H8O4 |
| Mw |
252.04225874 |
| CAS RN |
56594-54-8 |
| C_ID |
C00054629
|
| InChIKey |
AWRYPIXTWQTPSZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H8O4/c16-7-8-5-6-11-12(13(8)17)15(19)10-4-2-1-3-9(10)14(11)18/h1-7,17H |
| SMILES |
O=Cc1ccc2c(c1O)C(=O)c1ccccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda pandurifolia | Ref. |
|
|
zoom in
| Organism | Morinda pandurifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|