| Name |
Aloesol 7-Hydroxy-2-(2-hydroxypropyl)-5-methyl-4H-1-benzopyran-4-one |
| Formula |
C13H14O4 |
| Mw |
234.08920894 |
| CAS RN |
94356-35-1 |
| C_ID |
C00054589
|
| InChIKey |
ZYCNQWOKCMJKEZ-QMMMGPOBSA-N |
| InChICode |
InChI=1S/C13H14O4/c1-7-3-9(15)5-12-13(7)11(16)6-10(17-12)4-8(2)14/h3,5-6,8,14-15H,4H2,1-2H3/t8-/m0/s1 |
| SMILES |
Cc1cc(O)cc2oc(C[C@H](C)O)cc(=O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe spp.  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| - | - | Chinese rhubarb | Ref. |
|
|
zoom in
| Organism | Aloe vera | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|