| Name |
Artonin Q |
| Formula |
C31H30O8 |
| Mw |
530.19406794 |
| CAS RN |
161017-00-1 |
| C_ID |
C00053936
|
| InChIKey |
RYPVESRWZADKJR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C31H30O8/c1-14(2)8-9-17-26-16(10-11-30(5,6)39-26)24(33)22-25(34)19-12-18(15(3)4)23-21(28(19)38-27(17)22)20(32)13-31(23,36)29(35)37-7/h8,10-12,33,36H,3,9,13H2,1-2,4-7H3 |
| SMILES |
C=C(C)c1cc2c(=O)c3c(O)c4c(c(CC=C(C)C)c3oc2c2c1C(O)(C(=O)OC)CC2=O)OC(C)(C)C=C4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Artocarpus heterophyllus  | Ref. |
| Plantae | Turneraceae | Turnera ulmifolia  | Ref. |
|
|
zoom in
| Organism | Turnera ulmifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|