| Name |
Sylvestrene |
| Formula |
C10H16 |
| Mw |
136.12520051 |
| CAS RN |
1461-27-4 |
| C_ID |
C00053806
|
| InChIKey |
JWQKMEKSFPNAIB-SNVBAGLBSA-N |
| InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-5-9(3)7-10/h5,10H,1,4,6-7H2,2-3H3/t10-/m1/s1 |
| SMILES |
C=C(C)[C@@H]1CCC=C(C)C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
|
|
zoom in
| Organism | Thymus vulgaris | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|