| Name |
Subelliptenone D |
| Formula |
C20H16O6 |
| Mw |
352.09468824 |
| CAS RN |
161099-40-7 |
| C_ID |
C00053802
|
| InChIKey |
VSBRZDVIDWVOEU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H16O6/c1-4-20(2,3)11-8-12(21)15(23)13-14(22)10-7-9-5-6-25-17(9)16(24)18(10)26-19(11)13/h4-8,21,23-24H,1H2,2-3H3 |
| SMILES |
C=CC(C)(C)c1cc(O)c(O)c2c(=O)c3cc4ccoc4c(O)c3oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia subelliptica | Ref. |
|
|
zoom in
| Organism | Garcinia subelliptica | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|