| Name |
Garciniaxanthone C |
| Formula |
C23H24O5 |
| Mw |
380.16237388 |
| CAS RN |
156764-87-3 |
| C_ID |
C00053223
|
| InChIKey |
JBZNBOQELGIRMT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C23H24O5/c1-12(2)5-7-14-9-10-16-21(27)18-17(24)11-15(8-6-13(3)4)20(26)23(18)28-22(16)19(14)25/h5-6,9-11,24-26H,7-8H2,1-4H3 |
| SMILES |
CC(C)=CCc1ccc2c(=O)c3c(O)cc(CC=C(C)C)c(O)c3oc2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia subelliptica | Ref. |
|
|
zoom in
| Organism | Garcinia subelliptica |
|---|
| Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|
