| Name |
Garcibiphenyl C |
| Formula |
C14H14O4 |
| Mw |
246.08920894 |
| CAS RN |
916206-05-8 |
| C_ID |
C00053197
|
| InChIKey |
KMMVLPSUFLSVAH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H14O4/c1-17-12-7-10(8-13(18-2)14(12)16)9-3-5-11(15)6-4-9/h3-8,15-16H,1-2H3 |
| SMILES |
COc1cc(-c2ccc(O)cc2)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia linii | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia schomburgkiana | Ref. |
|
|
zoom in
| Organism | Garcinia schomburgkiana | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|