| Name |
Forbesione |
| Formula |
C28H32O6 |
| Mw |
464.21988875 |
| CAS RN |
180961-63-1 |
| C_ID |
C00053176
|
| InChIKey |
LWIGRTRTVVPXOZ-DLPQTZSGSA-N |
| InChICode |
InChI=1S/C28H32O6/c1-14(2)7-8-17-19(29)13-20(30)22-23(31)18-11-16-12-21-26(5,6)34-27(25(16)32,10-9-15(3)4)28(18,21)33-24(17)22/h7,9,11,13,16,21,29-30H,8,10,12H2,1-6H3/t16-,21+,27+,28-/m1/s1 |
| SMILES |
CC(C)=CCc1c(O)cc(O)c2c1O[C@]13C(=C[C@@H]4C[C@H]1C(C)(C)O[C@@]3(CC=C(C)C)C4=O)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia gaudichaudii | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia hanburyi  | Ref. |
|
|
zoom in
| Organism | Garcinia hanburyi | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|