| Name |
Carvacryl acetate Carvacrylacetate |
| Formula |
C12H16O2 |
| Mw |
192.11502975 |
| CAS RN |
6380-28-5 |
| C_ID |
C00053118
|
| InChIKey |
OXZSUQJHKQOGOK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H16O2/c1-8(2)11-6-5-9(3)12(7-11)14-10(4)13/h5-8H,1-4H3 |
| SMILES |
CC(=O)Oc1cc(C(C)C)ccc1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
|
|
zoom in
| Organism | Thymus broussonetti | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|