| Name |
Cyanidin 3-glucoside |
| Formula |
C21H21O11+ |
| Mw |
449.10838652 |
| CAS RN |
47705-70-4 |
| C_ID |
C00053092
|
| InChIKey |
RKWHWFONKJEUEF-GQUPQBGVSA-O |
| InChICode |
InChI=1S/C21H20O11/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8/h1-6,16-19,21-22,27-29H,7H2,(H3-,23,24,25,26)/p+1/t16-,17-,18+,19-,21-/m1/s1 |
| SMILES |
OC[C@H]1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium spp. | Ref. |
| Plantae | Araceae | Colocasia esculenta  | Ref. |
| Plantae | Lythraceae | Punica granatum L. | Ref. |
|
|
zoom in
| Organism | Colocasia esculenta |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
