| Name |
Blumenol C |
| Formula |
C13H22O2 |
| Mw |
210.16197995 |
| CAS RN |
36151-02-7 |
| C_ID |
C00053068
|
| InChIKey |
UEEJDIUOCUCVHN-PWSUYJOCSA-N |
| InChICode |
InChI=1S/C13H22O2/c1-9-7-11(15)8-13(3,4)12(9)6-5-10(2)14/h7,10,12,14H,5-6,8H2,1-4H3/t10-,12+/m1/s1 |
| SMILES |
CC1=CC(=O)CC(C)(C)[C@H]1CC[C@@H](C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
|
|
zoom in
| Organism | Asparagus officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|