| Name |
3-Oxotirucalla-7,24-dien-21-oic acid |
| Formula |
C30H46O3 |
| Mw |
454.34469533 |
| CAS RN |
82464-35-5 |
| C_ID |
C00052693
|
| InChIKey |
PYHNHGARAGBCRY-ZYHXIRFQSA-N |
| InChICode |
InChI=1S/C30H46O3/c1-19(2)9-8-10-20(26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h9,11,20-22,24H,8,10,12-18H2,1-7H3,(H,32,33)/t20-,21-,22-,24-,28+,29-,30+/m0/s1 |
| SMILES |
CC(C)=CCC[C@H](C(=O)O)[C@@H]1CC[C@]2(C)C3=CC[C@H]4C(C)(C)C(=O)CC[C@]4(C)[C@H]3CC[C@@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Nitrariaceae | Peganum harmala  | Ref. |
| Plantae | Nitrariaceae | Peganum nigellastrum | Ref. |
|
|
zoom in
| Organism | Peganum nigellastrum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|