| Name |
1,5,6-Trihydroxyxanthone |
| Formula |
C14H10O6 |
| Mw |
274.04773805 |
| CAS RN |
50868-52-5 |
| C_ID |
C00052530
|
| InChIKey |
JHOYIGDPCIBYKV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H10O6/c1-19-6-4-9(16)11-10(5-6)20-14-7(12(11)17)2-3-8(15)13(14)18/h2-5,15-16,18H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)c3ccc(O)c(O)c3oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia buchananii  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia eugenifolia | Ref. |
|
|
zoom in
| Organism | Garcinia eugenifolia | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|