| Name |
Vinorelbine |
| Formula |
C45H54N4O8 |
| Mw |
778.39416473 |
| CAS RN |
71486-22-1 |
| C_ID |
C00052432
|
| InChIKey |
GBABOYUKABKIAF-NKIQHDPCSA-N |
| InChICode |
InChI=1S/C45H54N4O8/c1-8-27-19-28-22-44(40(51)55-6,36-30(25-48(23-27)24-28)29-13-10-11-14-33(29)46-36)32-20-31-34(21-35(32)54-5)47(4)38-43(31)16-18-49-17-12-15-42(9-2,37(43)49)39(57-26(3)50)45(38,53)41(52)56-7/h10-15,19-21,28,37-39,46,53H,8-9,16-18,22-25H2,1-7H3/t28-,37+,38-,39-,42-,43-,44-,45+/m0/s1 |
| SMILES |
CCC1=C[C@@H]2C[N@@](C1)Cc1c([nH]c3ccccc13)[C@@](C(=O)OC)(c1cc3c(cc1OC)N(C)[C@@H]1[C@](O)(C(=O)OC)[C@@H](OC(C)=O)[C@@]4(CC)C=CCN5CC[C@@]31[C@H]54)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Vinca rosea | Ref. |
| - | - | Semisynthetic derivative | Ref. |
|
|
zoom in
| Organism | Vinca rosea |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
