| Name |
p-Methoxycinnamic acid |
| Formula |
C10H10O3 |
| Mw |
178.06299419 |
| CAS RN |
830-09-1 |
| C_ID |
C00051715
|
| InChIKey |
HPDXQTSWFBYAQF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H10O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12) |
| SMILES |
COc1ccc(C=COC=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Equisetaceae | Equisetum hiemale | Ref. |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
|
|
zoom in
| Organism | Scrophularia buergeriana |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Kim, et al., Phytochemistry, 54, (2000), 503 |
|---|
|
