| Name |
Methyl-4-O-methylgallate |
| Formula |
C9H10O5 |
| Mw |
198.05282343 |
| CAS RN |
24093-81-0 |
| C_ID |
C00051584
|
| InChIKey |
SUGIJIFASYORQN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H10O5/c1-13-8-6(10)3-5(4-7(8)11)9(12)14-2/h3-4,10-11H,1-2H3 |
| SMILES |
COC(=O)c1cc(O)c(OC)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Tagetes erecta  | Ref. |
| Plantae | Saxifragaceae | Chrysosplenium grayanum | Ref. |
|
|
zoom in
| Organism | Chrysosplenium grayanum |
|---|
| Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001) |
|---|
|
