| Name |
Methoxyadiantifoline |
| Formula |
C43H52N2O10 |
| Mw |
756.3621959 |
| CAS RN |
115452-09-0 |
| C_ID |
C00051546
|
| InChIKey |
NMCGVMFQTRAOOV-REMWNZQGNA-N |
| InChICode |
InChI=1S/C43H52N2O10/c1-44-14-12-25-28(21-36(49-6)41(52-9)39(25)50-7)29(44)17-24-19-32(46-3)34(48-5)22-31(24)55-35-18-23-16-30-37-26(13-15-45(30)2)40(51-8)43(54-11)42(53-10)38(37)27(23)20-33(35)47-4/h18-22,29-30H,12-17H2,1-11H3/t29-,30-/m0/s1 |
| SMILES |
COc1cc(C[C@H]2c3cc(OC)c(OC)c(OC)c3CCN2C)c(Oc2cc3c(cc2OC)-c2c(OC)c(OC)c(OC)c4c2[C@H](C3)N(C)CC4)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Thalictrum foetidum  | Ref. |
| Plantae | Ranunculaceae | Thalictrum omeiense | Ref. |
|
|
zoom in
| Organism | Thalictrum omeiense | | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001).
Xin, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 18, (1983), 920 |
|---|
|