| Name |
Mangiferolic acid |
| Formula |
C30H48O3 |
| Mw |
456.3603454 |
| CAS RN |
4184-34-3 |
| C_ID |
C00051458
|
| InChIKey |
MWMWRARQYAGHHF-QURJCWKQNA-N |
| InChICode |
InChI=1S/C30H48O3/c1-19(8-7-9-20(2)25(32)33)21-12-14-28(6)23-11-10-22-26(3,4)24(31)13-15-29(22)18-30(23,29)17-16-27(21,28)5/h9,19,21-24,31H,7-8,10-18H2,1-6H3,(H,32,33)/b20-9+/t19-,21-,22+,23+,24+,27-,28+,29-,30+/m1/s1 |
| SMILES |
C/C(=CCC[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C)OC=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Burseraceae | Commiphora wightii  | Ref. |
| Plantae | Illiciaceae | Illicium difengpi | Ref. |
|
|
zoom in
| Organism | Commiphora wightii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|