| Name |
Lutine |
| Formula |
C16H11NO5 |
| Mw |
297.06372247 |
| CAS RN |
66855-47-8 |
| C_ID |
C00051349
|
| InChIKey |
GAWWQRPONRAXSM-SAPNQHFASA-N |
| InChICode |
InChI=1S/C16H11NO2/c18-15-10-14(17-11-6-2-1-3-7-11)16(19)13-9-5-4-8-12(13)15/h1-10,18H |
| SMILES |
O=C1/C(=N/c2ccccc2)C=C(O)c2ccccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Microtoena prainiana | Ref. |
| Plantae | Resedaceae | Reseda luteola  | Ref. |
|
|
zoom in
| Organism | Reseda luteola | | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Li, et al., Journal of Natural Products, 67, (2004), 978 |
|---|
|