| Name |
Lederine |
| Formula |
C21H19NO7 |
| Mw |
397.11615197 |
| CAS RN |
76193-61-8 |
| C_ID |
C00051225
|
| InChIKey |
YAEIVKRDRYGJRD-QISKVVMTNA-N |
| InChICode |
InChI=1S/C21H19NO7/c1-10(23)29-20-17-12(2-3-14-18(17)28-9-25-14)19(24)21(20)13-7-16-15(26-8-27-16)6-11(13)4-5-22-21/h2-3,6-7,19-20,22,24H,4-5,8-9H2,1H3/t19-,20+,21+/m0/s1 |
| SMILES |
CC(=O)O[C@@H]1c2c(ccc3c2OCO3)[C@H](O)[C@@]12NCCc1cc3c(cc12)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis ledebouriana | Ref. |
| Plantae | Fumariaceae | Dicentra peregrina | Ref. |
|
|
zoom in
| Organism | Dicentra peregrina | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|