| Name |
Larreagenin A |
| Formula |
C29H44O3 |
| Mw |
440.32904527 |
| CAS RN |
53526-69-5 |
| C_ID |
C00051205
|
| InChIKey |
SVXQNFUGNPYYCZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C29H44O3/c1-24(2)20-9-12-28(6)21(26(20,4)11-10-22(24)30)8-7-18-19-17-25(3)13-15-29(19,23(31)32-25)16-14-27(18,28)5/h20-22,30H,7-17H2,1-6H3 |
| SMILES |
CC12CCC3(CCC4(C)C(=C3C1)CCC1C3(C)CCC(O)C(C)(C)C3CCC14C)C(=O)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Basellaceae | Anredera cordifolia  | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
|
|
zoom in
| Organism | Larrea divaricata | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|