| Name |
Kamebakaurin |
| Formula |
C20H30O5 |
| Mw |
350.20932407 |
| CAS RN |
73981-34-7 |
| C_ID |
C00051123
|
| InChIKey |
WHSUEVLJUHPROF-GNLNTTEDNA-N |
| InChICode |
InChI=1S/C20H30O5/c1-10-11-4-5-12-19(9-21)13(18(2,3)7-6-14(19)22)8-15(23)20(12,16(10)24)17(11)25/h11-15,17,21-23,25H,1,4-9H2,2-3H3/t11-,12-,13+,14-,15+,17?,19-,20-/m0/s1 |
| SMILES |
C=C1C(=O)[C@]23C(O)[C@H]1CC[C@H]2[C@@]1(CO)[C@H](C[C@H]3O)C(C)(C)CC[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Isodon japonica | Ref. |
| Plantae | Labiatae | Isodon kameba | Ref. |
| Plantae | Labiatae | Isodon umbrosa var.latifolia | Ref. |
| Plantae | Lamiaceae | Rabdosia excisa | Ref. |
| Plantae | Lamiaceae | Rabdosia longituba | Ref. |
|
|
zoom in
| Organism | Isodon kameba | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Gui, et al., Journal of Natural Products, 67, (2004), 373.
Sun, et al., Diterpenoids from Isodon Species, Science Press, Beijing, (2001).
Lee, et al., Planta Med, 70, (2004), 526 |
|---|
|