| Name |
Kakuol |
| Formula |
C10H10O4 |
| Mw |
194.05790881 |
| CAS RN |
18607-90-4 |
| C_ID |
C00051119
|
| InChIKey |
SLLMHZXMVHNZOR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H10O4/c1-2-7(11)6-3-9-10(4-8(6)12)14-5-13-9/h3-4,12H,2,5H2,1H3 |
| SMILES |
CCC(=O)c1cc2c(cc1O)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aristolochiaceae | Asarum forbesii | Ref. |
| Plantae | Aristolochiaceae | Asarum heterotropoides var.mandshuricum | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
|
|
zoom in
| Organism | Asarum heterotropoides var.mandshuricum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|