| Name |
Jatamansinol (+)-Lomatin |
| Formula |
C14H14O4 |
| Mw |
246.08920894 |
| CAS RN |
19380-05-3 |
| C_ID |
C00051026
|
| InChIKey |
UJSHBYQGQRPVNO-LDGXTIHJNA-N |
| InChICode |
InChI=1S/C14H14O4/c1-14(2)11(15)7-9-10(18-14)5-3-8-4-6-12(16)17-13(8)9/h3-6,11,15H,7H2,1-2H3/t11-/m1/s1 |
| SMILES |
CC1(C)Oc2ccc3ccc(=O)oc3c2C[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Valerianaceae | Nardostachys chinensis  | Ref. |
| Plantae | Valerianaceae | Nardostachys jatamansi  | Ref. |
| - | - | Libanotis buchtormensis | Ref. |
|
|
zoom in
| Organism | Nardostachys jatamansi | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|