| Name |
Acidissimin Jangomolide |
| Formula |
C26H28O8 |
| Mw |
468.17841787 |
| CAS RN |
93767-25-0 |
| C_ID |
C00051021
|
| InChIKey |
ZYPFSBYGJYBBBK-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C26H28O8/c1-22(2)15-11-16(27)24(4)14(25(15)9-6-17(28)31-21(25)34-22)5-8-23(3)18(13-7-10-30-12-13)32-20(29)19-26(23,24)33-19/h6-7,9-10,12,14-15,18-19,21H,5,8,11H2,1-4H3 |
| SMILES |
CC1(C)OC2OC(=O)C=CC23C1CC(=O)C1(C)C3CCC2(C)C(c3ccoc3)OC(=O)C3OC321 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Flacourtiaceae | Flacourtia jangomas  | Ref. |
| Plantae | Rutaceae | Evodia rutaecarpa  | Ref. |
| Plantae | Rutaceae | Limonia acidissima | Ref. |
|
|
zoom in
| Organism | Evodia rutaecarpa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|