| Name |
Isopicropodophyllone |
| Formula |
C22H20O8 |
| Mw |
412.11581762 |
| CAS RN |
55515-07-6 |
| C_ID |
C00050979
|
| InChIKey |
ISCQYPPCSYRZOT-IDJWPUQDNA-N |
| InChICode |
InChI=1S/C22H20O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-19H,8-9H2,1-3H3/t13-,18-,19+/m1/s1 |
| SMILES |
COc1cc([C@@H]2c3cc4c(cc3C(=O)[C@@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Diphylleia sinensis | Ref. |
| Plantae | Berberidaceae | Dysosma pleiantha | Ref. |
| Plantae | Berberidaceae | Podophyllum hexandrum  | Ref. |
| Plantae | Berberidaceae | Podophyllum peltatum | Ref. |
|
|
zoom in
| Organism | Dysosma pleiantha |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|
