| Name |
Isomyristicin |
| Formula |
C11H12O3 |
| Mw |
192.07864425 |
| CAS RN |
18312-21-5 |
| C_ID |
C00050961
|
| InChIKey |
DHUZAAUGHUHIDS-ONEGZZNKSA-N |
| InChICode |
InChI=1S/C11H12O3/c1-3-4-8-5-9(12-2)11-10(6-8)13-7-14-11/h3-6H,7H2,1-2H3/b4-3+ |
| SMILES |
C/C=C/c1cc(OC)c2c(c1)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Conioselinum vaginatum | Ref. |
| Plantae | Apiaceae | Ligusticum sinense  | Ref. |
| Plantae | Labiatae | Mosla scabra | Ref. |
|
|
zoom in
| Organism | Ligusticum sinense | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|