| Name |
Isolongifolene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
1135-66-6 |
| C_ID |
C00050947
|
| InChIKey |
CQUAYTJDLQBXCQ-UXYSATNRNA-N |
| InChICode |
InChI=1S/C15H24/c1-13(2)8-5-6-12-14(3,4)11-7-9-15(12,13)10-11/h6,11H,5,7-10H2,1-4H3/t11-,15-/m0/s1 |
| SMILES |
CC1(C)C2=CCCC(C)(C)[C@]23CC[C@H]1C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
|
|
zoom in
| Organism | Schisandra chinensis | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|