| Name |
Isogentialutine |
| Formula |
C9H11NO |
| Mw |
149.08406398 |
| CAS RN |
55399-77-4 |
| C_ID |
C00050934
|
| InChIKey |
IOIGOIPHPUCFOB-MWJXPZBXNA-N |
| InChICode |
InChI=1S/C9H11NO/c1-6-8-5-10-3-2-7(8)4-9(6)11/h2-3,5-6,9,11H,4H2,1H3/t6-,9-/m0/s1 |
| SMILES |
C[C@H]1c2cnccc2C[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Alstonia scholaris  | Ref. |
| Plantae | Gentianaceae | Gentiana tibetica | Ref. |
|
|
zoom in
| Organism | Gentiana tibetica |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
