| Name |
Isoeugenitin |
| Formula |
C12H12O4 |
| Mw |
220.07355887 |
| CAS RN |
519-18-6 |
| C_ID |
C00050926
|
| InChIKey |
DFAAYQHTFVTATL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H12O4/c1-6-4-8(13)11-9(14)5-10(15-3)7(2)12(11)16-6/h4-5,14H,1-3H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(C)oc2c1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Myrtaceae | Eugenia caryophyllata  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum | Ref. |
|
|
zoom in
| Organism | Syzygium aromaticum |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
