| Name |
Isocolumbin |
| Formula |
C20H22O6 |
| Mw |
358.14163844 |
| CAS RN |
471-54-5 |
| C_ID |
C00050890
|
| InChIKey |
AALLCALQGXXWNA-YNWNMNQCNA-N |
| InChICode |
InChI=1S/C20H22O6/c1-18-9-14(11-5-8-24-10-11)25-16(21)12(18)3-6-19(2)15(18)13-4-7-20(19,23)17(22)26-13/h4-5,7-8,10,12-15,23H,3,6,9H2,1-2H3/t12-,13-,14+,15+,18-,19-,20+/m0/s1 |
| SMILES |
C[C@]12C[C@H](c3ccoc3)OC(=O)[C@@H]1CC[C@@]1(C)[C@@H]2[C@@H]2C=C[C@@]1(O)C(=O)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Menispermaceae | Dioscoreophyllum cumminsii | Ref. |
| Plantae | Menispermaceae | Tinospora sagittata  | Ref. |
|
|
zoom in
| Organism | Tinospora sagittata | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|