| Name |
3-Keto-beta-ionone |
| Formula |
C13H18O2 |
| Mw |
206.13067982 |
| CAS RN |
27185-77-9 |
| C_ID |
C00050696
|
| InChIKey |
OBHGOXFSRVNKBS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H18O2/c1-9(14)5-6-11-10(2)12(15)7-8-13(11,3)4/h5-6H,7-8H2,1-4H3 |
| SMILES |
CC(=O)C=CC1=C(C)C(=O)CCC1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
|
|
zoom in
| Organism | Camellia sinensis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|